C11H14INO3 — CID 112757079
4-hydroxy-3-iodo-6-methyl-1-(oxolan-2-ylmethyl)pyridin-2-one (PubChem CID 112757079) has the molecular formula C11H14INO3 and a molecular weight of 335.14 g/mol. Its IUPAC name is 4-hydroxy-3-iodo-6-methyl-1-(oxolan-2-ylmethyl)pyridin-2-one.
| Compound Name | 4-hydroxy-3-iodo-6-methyl-1-(oxolan-2-ylmethyl)pyridin-2-one |
|---|---|
| PubChem CID | 112757079 |
| Molecular Formula | C11H14INO3 |
| Molecular Weight | 335.14 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 4-hydroxy-3-iodo-6-methyl-1-(oxolan-2-ylmethyl)pyridin-2-one |
| SMILES | Cc1cc(O)c(I)c(=O)n1CC1CCCO1 |
| InChI | InChI=1S/C11H14INO3/c1-7-5-9(14)10(12)11(15)13(7)6-8-3-2-4-16-8/h5,8,14H,2-4,6H2,1H3 |
| InChIKey | YFOHZHIKETWTNZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.14 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|