About 1-amino-1-[2-(1,4-dioxan-2-ylmethoxy)-4-fluorophenyl]-3-methylurea
1-amino-1-[2-(1,4-dioxan-2-ylmethoxy)-4-fluorophenyl]-3-methylurea (PubChem CID 144641252) has the molecular formula C13H18FN3O4
and a molecular weight of 299.30 g/mol. Its IUPAC name is 1-amino-1-[2-(1,4-dioxan-2-ylmethoxy)-4-fluorophenyl]-3-methylurea.
Molecular Properties
| Compound Name | 1-amino-1-[2-(1,4-dioxan-2-ylmethoxy)-4-fluorophenyl]-3-methylurea |
| PubChem CID | 144641252 |
| Molecular Formula | C13H18FN3O4 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-amino-1-[2-(1,4-dioxan-2-ylmethoxy)-4-fluorophenyl]-3-methylurea |
| SMILES | CNC(=O)N(N)c1ccc(F)cc1OCC1COCCO1 |
| InChI | InChI=1S/C13H18FN3O4/c1-16-13(18)17(15)11-3-2-9(14)6-12(11)21-8-10-7-19-4-5-20-10/h2-3,6,10H,4-5,7-8,15H2,1H3,(H,16,18) |
| InChIKey | HHSBBOTUTCOERG-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-1-[2-(1,4-dioxan-2-ylmethoxy)-4-fluorophenyl]-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-1-[2-(1,4-dioxan-2-ylmethoxy)-4-fluorophenyl]-3-methylurea?
The IUPAC name of 1-amino-1-[2-(1,4-dioxan-2-ylmethoxy)-4-fluorophenyl]-3-methylurea (CID 144641252) is 1-amino-1-[2-(1,4-dioxan-2-ylmethoxy)-4-fluorophenyl]-3-methylurea.
What is the SMILES notation for 1-amino-1-[2-(1,4-dioxan-2-ylmethoxy)-4-fluorophenyl]-3-methylurea?
The canonical SMILES for 1-amino-1-[2-(1,4-dioxan-2-ylmethoxy)-4-fluorophenyl]-3-methylurea is CNC(=O)N(N)c1ccc(F)cc1OCC1COCCO1.
What is the InChIKey of 1-amino-1-[2-(1,4-dioxan-2-ylmethoxy)-4-fluorophenyl]-3-methylurea?
The InChIKey is HHSBBOTUTCOERG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FN3O4/c1-16-13(18)17(15)11-3-2-9(14)6-12(11)21-8-10-7-19-4-5-20-10/h2-3,6,10H,4-5,7-8,15H2,1H3,(H,16,18).
What are the key properties of 1-amino-1-[2-(1,4-dioxan-2-ylmethoxy)-4-fluorophenyl]-3-methylurea?
1-amino-1-[2-(1,4-dioxan-2-ylmethoxy)-4-fluorophenyl]-3-methylurea has a molecular weight of 299.30 g/mol, XLogP of 0.64, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-1-[2-(1,4-dioxan-2-ylmethoxy)-4-fluorophenyl]-3-methylurea is sourced from PubChem (CID 144641252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).