C12H14ClNO3 — CID 89113099
5-chloro-N,4-dimethyl-2-[[(2S)-oxiran-2-yl]methoxy]benzamide (PubChem CID 89113099) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is 5-chloro-N,4-dimethyl-2-[[(2S)-oxiran-2-yl]methoxy]benzamide.
| Compound Name | 5-chloro-N,4-dimethyl-2-[[(2S)-oxiran-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 89113099 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 5-chloro-N,4-dimethyl-2-[[(2S)-oxiran-2-yl]methoxy]benzamide |
| SMILES | CNC(=O)c1cc(Cl)c(C)cc1OC[C@@H]1CO1 |
| InChI | InChI=1S/C12H14ClNO3/c1-7-3-11(17-6-8-5-16-8)9(4-10(7)13)12(15)14-2/h3-4,8H,5-6H2,1-2H3,(H,14,15)/t8-/m0/s1 |
| InChIKey | UZFCSHNBHLRQPU-QMMMGPOBSA-N |
| XLogP | 1.79 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|