C17H25BO6 — CID 140793635
2-[4-[[(2S)-1,4-dioxan-2-yl]methoxy]-3-methoxyphenyl]-4,4,5-trimethyl-1,3,2-dioxaborolane (PubChem CID 140793635) has the molecular formula C17H25BO6 and a molecular weight of 336.19 g/mol. Its IUPAC name is 2-[4-[[(2S)-1,4-dioxan-2-yl]methoxy]-3-methoxyphenyl]-4,4,5-trimethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[[(2S)-1,4-dioxan-2-yl]methoxy]-3-methoxyphenyl]-4,4,5-trimethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 140793635 |
| Molecular Formula | C17H25BO6 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-[4-[[(2S)-1,4-dioxan-2-yl]methoxy]-3-methoxyphenyl]-4,4,5-trimethyl-1,3,2-dioxaborolane |
| SMILES | COc1cc(B2OC(C)C(C)(C)O2)ccc1OC[C@@H]1COCCO1 |
| InChI | InChI=1S/C17H25BO6/c1-12-17(2,3)24-18(23-12)13-5-6-15(16(9-13)19-4)22-11-14-10-20-7-8-21-14/h5-6,9,12,14H,7-8,10-11H2,1-4H3/t12?,14-/m0/s1 |
| InChIKey | LYAFMYLIVHFFPO-PYMCNQPYSA-N |
| XLogP | 1.40 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|