C15H23BO4 — CID 174112943
2-(3,4-dimethoxyphenyl)-4,6-diethyl-1,3,2-dioxaborinane (PubChem CID 174112943) has the molecular formula C15H23BO4 and a molecular weight of 278.16 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-4,6-diethyl-1,3,2-dioxaborinane.
| Compound Name | 2-(3,4-dimethoxyphenyl)-4,6-diethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 174112943 |
| Molecular Formula | C15H23BO4 |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-4,6-diethyl-1,3,2-dioxaborinane |
| SMILES | CCC1CC(CC)OB(c2ccc(OC)c(OC)c2)O1 |
| InChI | InChI=1S/C15H23BO4/c1-5-12-10-13(6-2)20-16(19-12)11-7-8-14(17-3)15(9-11)18-4/h7-9,12-13H,5-6,10H2,1-4H3 |
| InChIKey | UKLZMUCZACTOFV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|