C20H22N2O5S — CID 167206676
12-[[(2S)-1,4-dioxan-2-yl]methoxy]-4-(3-hydroxy-3-methylbut-1-ynyl)-3-thia-9,11-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,11-tetraen-10-one (PubChem CID 167206676) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is 12-[[(2S)-1,4-dioxan-2-yl]methoxy]-4-(3-hydroxy-3-methylbut-1-ynyl)-3-thia-9,11-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,11-tetraen-10-one.
| Compound Name | 12-[[(2S)-1,4-dioxan-2-yl]methoxy]-4-(3-hydroxy-3-methylbut-1-ynyl)-3-thia-9,11-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,11-tetraen-10-one |
|---|---|
| PubChem CID | 167206676 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 12-[[(2S)-1,4-dioxan-2-yl]methoxy]-4-(3-hydroxy-3-methylbut-1-ynyl)-3-thia-9,11-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,11-tetraen-10-one |
| SMILES | CC(C)(O)C#Cc1cc2c(s1)-c1cc(OC[C@@H]3COCCO3)nc(=O)n1CC2 |
| InChI | InChI=1S/C20H22N2O5S/c1-20(2,24)5-3-15-9-13-4-6-22-16(18(13)28-15)10-17(21-19(22)23)27-12-14-11-25-7-8-26-14/h9-10,14,24H,4,6-8,11-12H2,1-2H3/t14-/m0/s1 |
| InChIKey | CBBQWOGNWAQFAN-AWEZNQCLSA-N |
| XLogP | 1.44 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|