C22H23NO5 — CID 166529900
2-(1,4-dioxan-2-ylmethoxy)-7-(4-ethoxyphenyl)-1H-quinolin-4-one (PubChem CID 166529900) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is 2-(1,4-dioxan-2-ylmethoxy)-7-(4-ethoxyphenyl)-1H-quinolin-4-one.
| Compound Name | 2-(1,4-dioxan-2-ylmethoxy)-7-(4-ethoxyphenyl)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 166529900 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-(1,4-dioxan-2-ylmethoxy)-7-(4-ethoxyphenyl)-1H-quinolin-4-one |
| SMILES | CCOc1ccc(-c2ccc3c(=O)cc(OCC4COCCO4)[nH]c3c2)cc1 |
| InChI | InChI=1S/C22H23NO5/c1-2-26-17-6-3-15(4-7-17)16-5-8-19-20(11-16)23-22(12-21(19)24)28-14-18-13-25-9-10-27-18/h3-8,11-12,18H,2,9-10,13-14H2,1H3,(H,23,24) |
| InChIKey | WSWCTYDTSSGULY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |