C24H33NO7S — CID 166529808
6-(1,4-dioxan-2-ylmethoxy)-3-ethyl-2-[2-[4-(3-methylsulfonylpropoxy)phenyl]ethyl]-1H-pyridin-4-one (PubChem CID 166529808) has the molecular formula C24H33NO7S and a molecular weight of 479.60 g/mol. Its IUPAC name is 6-(1,4-dioxan-2-ylmethoxy)-3-ethyl-2-[2-[4-(3-methylsulfonylpropoxy)phenyl]ethyl]-1H-pyridin-4-one.
| Compound Name | 6-(1,4-dioxan-2-ylmethoxy)-3-ethyl-2-[2-[4-(3-methylsulfonylpropoxy)phenyl]ethyl]-1H-pyridin-4-one |
|---|---|
| PubChem CID | 166529808 |
| Molecular Formula | C24H33NO7S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 6-(1,4-dioxan-2-ylmethoxy)-3-ethyl-2-[2-[4-(3-methylsulfonylpropoxy)phenyl]ethyl]-1H-pyridin-4-one |
| SMILES | CCc1c(CCc2ccc(OCCCS(C)(=O)=O)cc2)[nH]c(OCC2COCCO2)cc1=O |
| InChI | InChI=1S/C24H33NO7S/c1-3-21-22(25-24(15-23(21)26)32-17-20-16-29-12-13-31-20)10-7-18-5-8-19(9-6-18)30-11-4-14-33(2,27)28/h5-6,8-9,15,20H,3-4,7,10-14,16-17H2,1-2H3,(H,25,26) |
| InChIKey | DRRDHFHAMYDEOU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 103.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|