C26H37NO3 — CID 166530053
3-butyl-6-(oxan-2-ylmethoxy)-2-[2-(4-propylphenyl)ethyl]-1H-pyridin-4-one (PubChem CID 166530053) has the molecular formula C26H37NO3 and a molecular weight of 411.59 g/mol. Its IUPAC name is 3-butyl-6-(oxan-2-ylmethoxy)-2-[2-(4-propylphenyl)ethyl]-1H-pyridin-4-one.
| Compound Name | 3-butyl-6-(oxan-2-ylmethoxy)-2-[2-(4-propylphenyl)ethyl]-1H-pyridin-4-one |
|---|---|
| PubChem CID | 166530053 |
| Molecular Formula | C26H37NO3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | 3-butyl-6-(oxan-2-ylmethoxy)-2-[2-(4-propylphenyl)ethyl]-1H-pyridin-4-one |
| SMILES | CCCCc1c(CCc2ccc(CCC)cc2)[nH]c(OCC2CCCCO2)cc1=O |
| InChI | InChI=1S/C26H37NO3/c1-3-5-10-23-24(16-15-21-13-11-20(8-4-2)12-14-21)27-26(18-25(23)28)30-19-22-9-6-7-17-29-22/h11-14,18,22H,3-10,15-17,19H2,1-2H3,(H,27,28) |
| InChIKey | CUIQVZVQDYIAGN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |