C27H34N2O3 — CID 166529871
3-(1-methylpyrrol-3-yl)-6-(oxan-2-ylmethoxy)-2-[2-(4-propylphenyl)ethyl]-1H-pyridin-4-one (PubChem CID 166529871) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is 3-(1-methylpyrrol-3-yl)-6-(oxan-2-ylmethoxy)-2-[2-(4-propylphenyl)ethyl]-1H-pyridin-4-one.
| Compound Name | 3-(1-methylpyrrol-3-yl)-6-(oxan-2-ylmethoxy)-2-[2-(4-propylphenyl)ethyl]-1H-pyridin-4-one |
|---|---|
| PubChem CID | 166529871 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 3-(1-methylpyrrol-3-yl)-6-(oxan-2-ylmethoxy)-2-[2-(4-propylphenyl)ethyl]-1H-pyridin-4-one |
| SMILES | CCCc1ccc(CCc2[nH]c(OCC3CCCCO3)cc(=O)c2-c2ccn(C)c2)cc1 |
| InChI | InChI=1S/C27H34N2O3/c1-3-6-20-8-10-21(11-9-20)12-13-24-27(22-14-15-29(2)18-22)25(30)17-26(28-24)32-19-23-7-4-5-16-31-23/h8-11,14-15,17-18,23H,3-7,12-13,16,19H2,1-2H3,(H,28,30) |
| InChIKey | NRXCBVJBHOEAAR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |