C19H26N2O4 — CID 97253201
5,5-diethyl-3-[[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]methyl]imidazolidine-2,4-dione (PubChem CID 97253201) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 5,5-diethyl-3-[[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-diethyl-3-[[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97253201 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 5,5-diethyl-3-[[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]methyl]imidazolidine-2,4-dione |
| SMILES | CCC1(CC)NC(=O)N(Cc2ccc(OC[C@@H]3CCCO3)cc2)C1=O |
| InChI | InChI=1S/C19H26N2O4/c1-3-19(4-2)17(22)21(18(23)20-19)12-14-7-9-15(10-8-14)25-13-16-6-5-11-24-16/h7-10,16H,3-6,11-13H2,1-2H3,(H,20,23)/t16-/m0/s1 |
| InChIKey | HXDKRKPJTQYNPD-INIZCTEOSA-N |
| XLogP | 2.86 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|