C58H56N4O6 — CID 136913274
5,10,15-tris(4-methylphenyl)-20-[4-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethoxy)phenyl]-21,23-dihydroporphyrin (PubChem CID 136913274) has the molecular formula C58H56N4O6 and a molecular weight of 905.11 g/mol. Its IUPAC name is 5,10,15-tris(4-methylphenyl)-20-[4-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethoxy)phenyl]-21,23-dihydroporphyrin.
| Compound Name | 5,10,15-tris(4-methylphenyl)-20-[4-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethoxy)phenyl]-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136913274 |
| Molecular Formula | C58H56N4O6 |
| Molecular Weight | 905.11 g/mol |
| Exact Mass | 904.42 |
| IUPAC Name | 5,10,15-tris(4-methylphenyl)-20-[4-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethoxy)phenyl]-21,23-dihydroporphyrin |
| SMILES | Cc1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4ccc(OCC5COCCOCCOCCOCCO5)cc4)c4nc(c(-c5ccc(C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C58H56N4O6/c1-38-4-10-41(11-5-38)55-47-20-22-49(59-47)56(42-12-6-39(2)7-13-42)51-24-26-53(61-51)58(54-27-25-52(62-54)57(50-23-21-48(55)60-50)43-14-8-40(3)9-15-43)44-16-18-45(19-17-44)68-37-46-36-66-33-32-64-29-28-63-30-31-65-34-35-67-46/h4-27,46,59,62H,28-37H2,1-3H3/b55-47-,55-48-,56-49-,56-51-,57-50-,57-52-,58-53-,58-54- |
| InChIKey | ROXCXFKZTCHVKE-MXRZNNOWSA-N |
| XLogP | 12.09 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.11 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |