C42H32N4 — CID 136843859
5,10,15-tri(cyclopenta-1,3-dien-1-yl)-20-(4-methylphenyl)-21,23-dihydroporphyrin (PubChem CID 136843859) has the molecular formula C42H32N4 and a molecular weight of 592.75 g/mol. Its IUPAC name is 5,10,15-tri(cyclopenta-1,3-dien-1-yl)-20-(4-methylphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15-tri(cyclopenta-1,3-dien-1-yl)-20-(4-methylphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136843859 |
| Molecular Formula | C42H32N4 |
| Molecular Weight | 592.75 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | 5,10,15-tri(cyclopenta-1,3-dien-1-yl)-20-(4-methylphenyl)-21,23-dihydroporphyrin |
| SMILES | Cc1ccc(-c2c3nc(c(C4=CC=CC4)c4ccc([nH]4)c(C4=CC=CC4)c4nc(c(C5=CC=CC5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C42H32N4/c1-26-14-16-30(17-15-26)42-37-24-22-35(45-37)40(28-10-4-5-11-28)33-20-18-31(43-33)39(27-8-2-3-9-27)32-19-21-34(44-32)41(29-12-6-7-13-29)36-23-25-38(42)46-36/h2-8,10,12,14-25,43,46H,9,11,13H2,1H3/b39-31-,39-32-,40-33-,40-35-,41-34-,41-36-,42-37-,42-38- |
| InChIKey | BIOPLCAGDILLBI-DGDPQLBNSA-N |
| XLogP | 10.66 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.75 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |