C48H42N4 — CID 136801563
5,10,15,20-tetrakis(4-methylphenyl)-2,3,7,8,21,23-hexahydroporphyrin (PubChem CID 136801563) has the molecular formula C48H42N4 and a molecular weight of 674.89 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(4-methylphenyl)-2,3,7,8,21,23-hexahydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(4-methylphenyl)-2,3,7,8,21,23-hexahydroporphyrin |
|---|---|
| PubChem CID | 136801563 |
| Molecular Formula | C48H42N4 |
| Molecular Weight | 674.89 g/mol |
| Exact Mass | 674.34 |
| IUPAC Name | 5,10,15,20-tetrakis(4-methylphenyl)-2,3,7,8,21,23-hexahydroporphyrin |
| SMILES | Cc1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4ccc(C)cc4)c4nc(c(-c5ccc(C)cc5)c5[nH]c2CC5)CC4)C=C3)cc1 |
| InChI | InChI=1S/C48H42N4/c1-29-5-13-33(14-6-29)45-37-21-23-39(49-37)46(34-15-7-30(2)8-16-34)41-25-27-43(51-41)48(36-19-11-32(4)12-20-36)44-28-26-42(52-44)47(40-24-22-38(45)50-40)35-17-9-31(3)10-18-35/h5-24,49,52H,25-28H2,1-4H3/b45-38-,46-41-,47-42-,48-44- |
| InChIKey | FNPIYZULYAHFSD-MNABLKKGSA-N |
| XLogP | 11.68 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.89 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |