C29H42O10 — CID 15721738
28-methoxy-12-(phenylmethoxymethyl)-2,5,8,11,14,17,20,23-octaoxabicyclo[22.3.1]octacosa-1(27),24(28),25-triene (PubChem CID 15721738) has the molecular formula C29H42O10 and a molecular weight of 550.65 g/mol. Its IUPAC name is 28-methoxy-12-(phenylmethoxymethyl)-2,5,8,11,14,17,20,23-octaoxabicyclo[22.3.1]octacosa-1(27),24(28),25-triene.
| Compound Name | 28-methoxy-12-(phenylmethoxymethyl)-2,5,8,11,14,17,20,23-octaoxabicyclo[22.3.1]octacosa-1(27),24(28),25-triene |
|---|---|
| PubChem CID | 15721738 |
| Molecular Formula | C29H42O10 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | 28-methoxy-12-(phenylmethoxymethyl)-2,5,8,11,14,17,20,23-octaoxabicyclo[22.3.1]octacosa-1(27),24(28),25-triene |
| SMILES | COc1c2cccc1OCCOCCOCCOC(COCc1ccccc1)COCCOCCOCCO2 |
| InChI | InChI=1S/C29H42O10/c1-30-29-27-8-5-9-28(29)39-21-18-34-13-12-32-16-19-37-26(24-36-22-25-6-3-2-4-7-25)23-35-15-14-31-10-11-33-17-20-38-27/h2-9,26H,10-24H2,1H3 |
| InChIKey | WDJLBQIKWDJMCQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |