C23H39NO2Si — CID 11292204
[(1R,4aR,8R,8aR)-4a-methyl-1-(phenylmethoxymethyl)-8-trimethylsilyloxy-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-yl]methanamine (PubChem CID 11292204) has the molecular formula C23H39NO2Si and a molecular weight of 389.66 g/mol. Its IUPAC name is [(1R,4aR,8R,8aR)-4a-methyl-1-(phenylmethoxymethyl)-8-trimethylsilyloxy-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-yl]methanamine.
| Compound Name | [(1R,4aR,8R,8aR)-4a-methyl-1-(phenylmethoxymethyl)-8-trimethylsilyloxy-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-yl]methanamine |
|---|---|
| PubChem CID | 11292204 |
| Molecular Formula | C23H39NO2Si |
| Molecular Weight | 389.66 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | [(1R,4aR,8R,8aR)-4a-methyl-1-(phenylmethoxymethyl)-8-trimethylsilyloxy-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-yl]methanamine |
| SMILES | C[C@@]12CCC[C@@H](O[Si](C)(C)C)[C@H]1[C@](CN)(COCc1ccccc1)CCC2 |
| InChI | InChI=1S/C23H39NO2Si/c1-22-13-8-12-20(26-27(2,3)4)21(22)23(17-24,15-9-14-22)18-25-16-19-10-6-5-7-11-19/h5-7,10-11,20-21H,8-9,12-18,24H2,1-4H3/t20-,21-,22+,23-/m1/s1 |
| InChIKey | JMIMRXBIUYCSJI-BXXSPATCSA-N |
| XLogP | 5.36 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.66 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|