C15H21NO3 — CID 10491797
N-[(1R,2R)-2-hydroxy-2-(phenylmethoxymethyl)cyclopentyl]acetamide (PubChem CID 10491797) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxy-2-(phenylmethoxymethyl)cyclopentyl]acetamide.
| Compound Name | N-[(1R,2R)-2-hydroxy-2-(phenylmethoxymethyl)cyclopentyl]acetamide |
|---|---|
| PubChem CID | 10491797 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-[(1R,2R)-2-hydroxy-2-(phenylmethoxymethyl)cyclopentyl]acetamide |
| SMILES | CC(=O)N[C@@H]1CCC[C@]1(O)COCc1ccccc1 |
| InChI | InChI=1S/C15H21NO3/c1-12(17)16-14-8-5-9-15(14,18)11-19-10-13-6-3-2-4-7-13/h2-4,6-7,14,18H,5,8-11H2,1H3,(H,16,17)/t14-,15+/m1/s1 |
| InChIKey | QZIVXYVSHILSCO-CABCVRRESA-N |
| XLogP | 1.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |