C30H44OSi — CID 100971777
[(3R,5R,8R,9S,10R,13S,14S,17Z)-17-ethylidene-10,13-dimethyl-6-methylidene-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-dimethyl-phenylsilane (PubChem CID 100971777) has the molecular formula C30H44OSi and a molecular weight of 448.77 g/mol. Its IUPAC name is [(3R,5R,8R,9S,10R,13S,14S,17Z)-17-ethylidene-10,13-dimethyl-6-methylidene-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-dimethyl-phenylsilane.
| Compound Name | [(3R,5R,8R,9S,10R,13S,14S,17Z)-17-ethylidene-10,13-dimethyl-6-methylidene-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 100971777 |
| Molecular Formula | C30H44OSi |
| Molecular Weight | 448.77 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | [(3R,5R,8R,9S,10R,13S,14S,17Z)-17-ethylidene-10,13-dimethyl-6-methylidene-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-dimethyl-phenylsilane |
| SMILES | C=C1C[C@@H]2[C@H](CC[C@]3(C)/C(=C\C)CC[C@@H]23)[C@@]2(C)CC[C@@H](O[Si](C)(C)c3ccccc3)C[C@H]12 |
| InChI | InChI=1S/C30H44OSi/c1-7-22-13-14-26-25-19-21(2)28-20-23(31-32(5,6)24-11-9-8-10-12-24)15-17-30(28,4)27(25)16-18-29(22,26)3/h7-12,23,25-28H,2,13-20H2,1,3-6H3/b22-7-/t23-,25+,26+,27+,28-,29-,30-/m1/s1 |
| InChIKey | RLMMWAXHXBCFJR-BQSWFXOUSA-N |
| XLogP | 7.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.77 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|