C49H58O4 — CID 58651687
(1S,3S,6R,7R,10R,13S,17Z)-17-ethylidene-10,13-dimethyl-1,3,6,7-tetrakis(phenylmethoxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene (PubChem CID 58651687) has the molecular formula C49H58O4 and a molecular weight of 711.00 g/mol. Its IUPAC name is (1S,3S,6R,7R,10R,13S,17Z)-17-ethylidene-10,13-dimethyl-1,3,6,7-tetrakis(phenylmethoxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene.
| Compound Name | (1S,3S,6R,7R,10R,13S,17Z)-17-ethylidene-10,13-dimethyl-1,3,6,7-tetrakis(phenylmethoxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 58651687 |
| Molecular Formula | C49H58O4 |
| Molecular Weight | 711.00 g/mol |
| Exact Mass | 710.43 |
| IUPAC Name | (1S,3S,6R,7R,10R,13S,17Z)-17-ethylidene-10,13-dimethyl-1,3,6,7-tetrakis(phenylmethoxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene |
| SMILES | C/C=C1/CCC2C3C(OCc4ccccc4)[C@H](OCc4ccccc4)C4C[C@H](OCc5ccccc5)C[C@H](OCc5ccccc5)[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C49H58O4/c1-4-39-25-26-41-45-42(27-28-48(39,41)2)49(3)43(46(52-33-37-21-13-7-14-22-37)47(45)53-34-38-23-15-8-16-24-38)29-40(50-31-35-17-9-5-10-18-35)30-44(49)51-32-36-19-11-6-12-20-36/h4-24,40-47H,25-34H2,1-3H3/b39-4-/t40-,41?,42?,43?,44-,45?,46+,47?,48+,49+/m0/s1 |
| InChIKey | KETAQPYKACFQBC-IRJAXCOVSA-N |
| XLogP | 11.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.00 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|