C21H36ClNO2 — CID 162314369
(3R,6R,7R,10R,13S,17Z)-3-amino-17-ethylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-6,7-diol;hydrochloride (PubChem CID 162314369) has the molecular formula C21H36ClNO2 and a molecular weight of 369.98 g/mol. Its IUPAC name is (3R,6R,7R,10R,13S,17Z)-3-amino-17-ethylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-6,7-diol;hydrochloride.
| Compound Name | (3R,6R,7R,10R,13S,17Z)-3-amino-17-ethylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-6,7-diol;hydrochloride |
|---|---|
| PubChem CID | 162314369 |
| Molecular Formula | C21H36ClNO2 |
| Molecular Weight | 369.98 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | (3R,6R,7R,10R,13S,17Z)-3-amino-17-ethylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-6,7-diol;hydrochloride |
| SMILES | C/C=C1/CCC2C3C(O)[C@H](O)C4C[C@H](N)CC[C@]4(C)C3CC[C@]12C.Cl |
| InChI | InChI=1S/C21H35NO2.ClH/c1-4-12-5-6-14-17-15(8-10-20(12,14)2)21(3)9-7-13(22)11-16(21)18(23)19(17)24;/h4,13-19,23-24H,5-11,22H2,1-3H3;1H/b12-4-;/t13-,14?,15?,16?,17?,18-,19?,20-,21-;/m1./s1 |
| InChIKey | BCPTVOLPGFVWTC-RRBMVXRRSA-N |
| XLogP | 3.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.98 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|