C23H38O — CID 134179920
(3R,5S,8R,9S,10S,13S,14S,17Z)-17-ethylidene-3,7,10,13-tetramethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 134179920) has the molecular formula C23H38O and a molecular weight of 330.56 g/mol. Its IUPAC name is (3R,5S,8R,9S,10S,13S,14S,17Z)-17-ethylidene-3,7,10,13-tetramethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5S,8R,9S,10S,13S,14S,17Z)-17-ethylidene-3,7,10,13-tetramethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 134179920 |
| Molecular Formula | C23H38O |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.29 |
| IUPAC Name | (3R,5S,8R,9S,10S,13S,14S,17Z)-17-ethylidene-3,7,10,13-tetramethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C/C=C1/CC[C@H]2[C@@H]3C(C)C[C@H]4C[C@](C)(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H38O/c1-6-16-7-8-18-20-15(2)13-17-14-21(3,24)11-12-23(17,5)19(20)9-10-22(16,18)4/h6,15,17-20,24H,7-14H2,1-5H3/b16-6-/t15?,17-,18-,19-,20-,21+,22+,23-/m0/s1 |
| InChIKey | UBGZKLFIYGSTGH-QWAJMFEPSA-N |
| XLogP | 5.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|