C25H42O3 — CID 142094554
(3R,10S,13S,17Z)-17-ethylidene-7-(2-methoxypropan-2-yloxy)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 142094554) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is (3R,10S,13S,17Z)-17-ethylidene-7-(2-methoxypropan-2-yloxy)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,10S,13S,17Z)-17-ethylidene-7-(2-methoxypropan-2-yloxy)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 142094554 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | (3R,10S,13S,17Z)-17-ethylidene-7-(2-methoxypropan-2-yloxy)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C/C=C1/CCC2C3C(OC(C)(C)OC)CC4C[C@H](O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C25H42O3/c1-7-16-8-9-19-22-20(11-13-24(16,19)4)25(5)12-10-18(26)14-17(25)15-21(22)28-23(2,3)27-6/h7,17-22,26H,8-15H2,1-6H3/b16-7-/t17?,18-,19?,20?,21?,22?,24-,25+/m1/s1 |
| InChIKey | RFUOOOYTYKMMIE-WVQRKQSQSA-N |
| XLogP | 5.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|