C19H33O5P — CID 69004323
[(3S,5R,8R,9S,10S,13S,14R,17S)-17-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] dihydrogen phosphate (PubChem CID 69004323) has the molecular formula C19H33O5P and a molecular weight of 372.44 g/mol. Its IUPAC name is [(3S,5R,8R,9S,10S,13S,14R,17S)-17-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] dihydrogen phosphate.
| Compound Name | [(3S,5R,8R,9S,10S,13S,14R,17S)-17-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 69004323 |
| Molecular Formula | C19H33O5P |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | [(3S,5R,8R,9S,10S,13S,14R,17S)-17-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] dihydrogen phosphate |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@@H](OP(=O)(O)O)CC[C@@]43C)[C@H]1CC[C@@H]2O |
| InChI | InChI=1S/C19H33O5P/c1-18-9-7-13(24-25(21,22)23)11-12(18)3-4-14-15-5-6-17(20)19(15,2)10-8-16(14)18/h12-17,20H,3-11H2,1-2H3,(H2,21,22,23)/t12-,13+,14+,15-,16+,17+,18+,19+/m1/s1 |
| InChIKey | XGQUSGJFPMVBMN-HKQJUHHRSA-N |
| XLogP | 3.87 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|