C40H75N5O — CID 142305135
acetylene;4-[3-[3-[3-(3-aminopropylamino)propylamino]propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-di(propan-2-yl)butanamide (PubChem CID 142305135) has the molecular formula C40H75N5O and a molecular weight of 642.07 g/mol. Its IUPAC name is acetylene;4-[3-[3-[3-(3-aminopropylamino)propylamino]propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-di(propan-2-yl)butanamide.
| Compound Name | acetylene;4-[3-[3-[3-(3-aminopropylamino)propylamino]propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-di(propan-2-yl)butanamide |
|---|---|
| PubChem CID | 142305135 |
| Molecular Formula | C40H75N5O |
| Molecular Weight | 642.07 g/mol |
| Exact Mass | 641.60 |
| IUPAC Name | acetylene;4-[3-[3-[3-(3-aminopropylamino)propylamino]propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-di(propan-2-yl)butanamide |
| SMILES | C#C.CC(C)N(C(=O)CCCC1CCC2C3CCC4CC(NCCCNCCCNCCCN)CCC4(C)C3CCC12C)C(C)C |
| InChI | InChI=1S/C38H73N5O.C2H2/c1-28(2)43(29(3)4)36(44)12-7-11-30-14-16-34-33-15-13-31-27-32(17-19-38(31,6)35(33)18-20-37(30,34)5)42-26-10-25-41-24-9-23-40-22-8-21-39;1-2/h28-35,40-42H,7-27,39H2,1-6H3;1-2H |
| InChIKey | QDRNBRKAGYQPBB-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.07 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|