C31H58N2O — CID 134255436
(3S,5R,7R,10S,13R,17R)-3-[(3-aminopropylamino)methyl]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol (PubChem CID 134255436) has the molecular formula C31H58N2O and a molecular weight of 474.82 g/mol. Its IUPAC name is (3S,5R,7R,10S,13R,17R)-3-[(3-aminopropylamino)methyl]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol.
| Compound Name | (3S,5R,7R,10S,13R,17R)-3-[(3-aminopropylamino)methyl]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol |
|---|---|
| PubChem CID | 134255436 |
| Molecular Formula | C31H58N2O |
| Molecular Weight | 474.82 g/mol |
| Exact Mass | 474.45 |
| IUPAC Name | (3S,5R,7R,10S,13R,17R)-3-[(3-aminopropylamino)methyl]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3C(O)C[C@H]4C[C@@H](CNCCCN)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C31H58N2O/c1-21(2)8-6-9-22(3)25-10-11-26-29-27(13-15-31(25,26)5)30(4)14-12-23(20-33-17-7-16-32)18-24(30)19-28(29)34/h21-29,33-34H,6-20,32H2,1-5H3/t22-,23+,24-,25-,26?,27?,28?,29?,30+,31-/m1/s1 |
| InChIKey | SDEWZRHABPGCTR-LBGHSSEESA-N |
| XLogP | 6.63 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.82 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|