C36H58N2O3 — CID 161422343
methyl (4R)-4-[(3R,5R,10S,13R,17R)-3-[4-(benzylamino)butylamino]-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 161422343) has the molecular formula C36H58N2O3 and a molecular weight of 566.87 g/mol. Its IUPAC name is methyl (4R)-4-[(3R,5R,10S,13R,17R)-3-[4-(benzylamino)butylamino]-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(3R,5R,10S,13R,17R)-3-[4-(benzylamino)butylamino]-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 161422343 |
| Molecular Formula | C36H58N2O3 |
| Molecular Weight | 566.87 g/mol |
| Exact Mass | 566.44 |
| IUPAC Name | methyl (4R)-4-[(3R,5R,10S,13R,17R)-3-[4-(benzylamino)butylamino]-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)[C@H]1CCC2C3C(O)C[C@H]4C[C@H](NCCCCNCc5ccccc5)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C36H58N2O3/c1-25(12-15-33(40)41-4)29-13-14-30-34-31(17-19-36(29,30)3)35(2)18-16-28(22-27(35)23-32(34)39)38-21-9-8-20-37-24-26-10-6-5-7-11-26/h5-7,10-11,25,27-32,34,37-39H,8-9,12-24H2,1-4H3/t25-,27-,28-,29-,30?,31?,32?,34?,35+,36-/m1/s1 |
| InChIKey | DHMUKCNUQPGTRW-JBJWRLEASA-N |
| XLogP | 6.73 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.87 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|