C30H54N2O3 — CID 118000017
methyl (4R)-4-[(3S,5R,7R,10S,13R,17R)-7-hydroxy-10,13-dimethyl-3-[2-(propan-2-ylamino)ethylamino]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 118000017) has the molecular formula C30H54N2O3 and a molecular weight of 490.77 g/mol. Its IUPAC name is methyl (4R)-4-[(3S,5R,7R,10S,13R,17R)-7-hydroxy-10,13-dimethyl-3-[2-(propan-2-ylamino)ethylamino]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(3S,5R,7R,10S,13R,17R)-7-hydroxy-10,13-dimethyl-3-[2-(propan-2-ylamino)ethylamino]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 118000017 |
| Molecular Formula | C30H54N2O3 |
| Molecular Weight | 490.77 g/mol |
| Exact Mass | 490.41 |
| IUPAC Name | methyl (4R)-4-[(3S,5R,7R,10S,13R,17R)-7-hydroxy-10,13-dimethyl-3-[2-(propan-2-ylamino)ethylamino]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)[C@H]1CCC2C3C(O)C[C@H]4C[C@@H](NCCNC(C)C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C30H54N2O3/c1-19(2)31-15-16-32-22-11-13-29(4)21(17-22)18-26(33)28-24-9-8-23(20(3)7-10-27(34)35-6)30(24,5)14-12-25(28)29/h19-26,28,31-33H,7-18H2,1-6H3/t20-,21-,22+,23-,24?,25?,26?,28?,29+,30-/m1/s1 |
| InChIKey | VBFLCQWFYIHQFR-DBWIVNEJSA-N |
| XLogP | 5.16 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.77 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|