C35H57N3O2 — CID 163509141
methyl 4-[(3S,5S,10S,13R,17R)-10,13-dimethyl-3-[4-(pyridin-2-ylmethylamino)butylamino]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 163509141) has the molecular formula C35H57N3O2 and a molecular weight of 551.86 g/mol. Its IUPAC name is methyl 4-[(3S,5S,10S,13R,17R)-10,13-dimethyl-3-[4-(pyridin-2-ylmethylamino)butylamino]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl 4-[(3S,5S,10S,13R,17R)-10,13-dimethyl-3-[4-(pyridin-2-ylmethylamino)butylamino]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 163509141 |
| Molecular Formula | C35H57N3O2 |
| Molecular Weight | 551.86 g/mol |
| Exact Mass | 551.45 |
| IUPAC Name | methyl 4-[(3S,5S,10S,13R,17R)-10,13-dimethyl-3-[4-(pyridin-2-ylmethylamino)butylamino]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CCC(C)[C@H]1CCC2C3CC[C@H]4C[C@@H](NCCCCNCc5ccccn5)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C35H57N3O2/c1-25(10-15-33(39)40-4)30-13-14-31-29-12-11-26-23-27(16-18-34(26,2)32(29)17-19-35(30,31)3)37-22-8-7-20-36-24-28-9-5-6-21-38-28/h5-6,9,21,25-27,29-32,36-37H,7-8,10-20,22-24H2,1-4H3/t25?,26-,27-,29?,30+,31?,32?,34-,35+/m0/s1 |
| InChIKey | DBEBXAPMRVSSEC-UBDZGGMWSA-N |
| XLogP | 7.16 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.86 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|