C28H46O — CID 153339779
ethane;(6Z)-6-ethylidene-10,13-dimethyl-17-pent-4-enyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-one (PubChem CID 153339779) has the molecular formula C28H46O and a molecular weight of 398.68 g/mol. Its IUPAC name is ethane;(6Z)-6-ethylidene-10,13-dimethyl-17-pent-4-enyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-one.
| Compound Name | ethane;(6Z)-6-ethylidene-10,13-dimethyl-17-pent-4-enyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-one |
|---|---|
| PubChem CID | 153339779 |
| Molecular Formula | C28H46O |
| Molecular Weight | 398.68 g/mol |
| Exact Mass | 398.35 |
| IUPAC Name | ethane;(6Z)-6-ethylidene-10,13-dimethyl-17-pent-4-enyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-one |
| SMILES | C=CCCCC1CCC2C3C(=O)/C(=C\C)C4CCCCC4(C)C3CCC12C.CC |
| InChI | InChI=1S/C26H40O.C2H6/c1-5-7-8-11-18-13-14-21-23-22(15-17-25(18,21)3)26(4)16-10-9-12-20(26)19(6-2)24(23)27;1-2/h5-6,18,20-23H,1,7-17H2,2-4H3;1-2H3/b19-6-; |
| InChIKey | LDFVKYVZVXPLML-AUIYKLQISA-N |
| XLogP | 8.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.68 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|