C24H38O — CID 145410529
(6E)-6-ethylidene-10,13-dimethyl-17-propyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-one (PubChem CID 145410529) has the molecular formula C24H38O and a molecular weight of 342.57 g/mol. Its IUPAC name is (6E)-6-ethylidene-10,13-dimethyl-17-propyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-one.
| Compound Name | (6E)-6-ethylidene-10,13-dimethyl-17-propyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-one |
|---|---|
| PubChem CID | 145410529 |
| Molecular Formula | C24H38O |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.29 |
| IUPAC Name | (6E)-6-ethylidene-10,13-dimethyl-17-propyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-one |
| SMILES | C/C=C1/C(=O)C2C3CCC(CCC)C3(C)CCC2C2(C)CCCCC12 |
| InChI | InChI=1S/C24H38O/c1-5-9-16-11-12-19-21-20(13-15-23(16,19)3)24(4)14-8-7-10-18(24)17(6-2)22(21)25/h6,16,18-21H,5,7-15H2,1-4H3/b17-6+ |
| InChIKey | RXTIPOVGPNIZEY-UBKPWBPPSA-N |
| XLogP | 6.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|