C29H46O3 — CID 153329171
ethyl (4R)-4-[(3R,6Z)-6-ethylidene-3,10,13-trimethyl-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 153329171) has the molecular formula C29H46O3 and a molecular weight of 442.68 g/mol. Its IUPAC name is ethyl (4R)-4-[(3R,6Z)-6-ethylidene-3,10,13-trimethyl-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | ethyl (4R)-4-[(3R,6Z)-6-ethylidene-3,10,13-trimethyl-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 153329171 |
| Molecular Formula | C29H46O3 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | ethyl (4R)-4-[(3R,6Z)-6-ethylidene-3,10,13-trimethyl-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | C/C=C1\C(=O)C2C(CCC3(C)C2CCC3[C@H](C)CCC(=O)OCC)C2(C)CC[C@@H](C)CC12 |
| InChI | InChI=1S/C29H46O3/c1-7-20-24-17-18(3)13-15-29(24,6)23-14-16-28(5)21(10-11-22(28)26(23)27(20)31)19(4)9-12-25(30)32-8-2/h7,18-19,21-24,26H,8-17H2,1-6H3/b20-7-/t18-,19-,21?,22?,23?,24?,26?,28?,29?/m1/s1 |
| InChIKey | ZFEVCMUZNKVZLD-CEUJQSGTSA-N |
| XLogP | 7.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|