C35H60O5 — CID 153329130
ethane;ethyl (4R)-4-[(3R,6Z)-6-ethylidene-10,13-dimethyl-7-oxo-3-propanoyloxy-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 153329130) has the molecular formula C35H60O5 and a molecular weight of 560.86 g/mol. Its IUPAC name is ethane;ethyl (4R)-4-[(3R,6Z)-6-ethylidene-10,13-dimethyl-7-oxo-3-propanoyloxy-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | ethane;ethyl (4R)-4-[(3R,6Z)-6-ethylidene-10,13-dimethyl-7-oxo-3-propanoyloxy-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 153329130 |
| Molecular Formula | C35H60O5 |
| Molecular Weight | 560.86 g/mol |
| Exact Mass | 560.44 |
| IUPAC Name | ethane;ethyl (4R)-4-[(3R,6Z)-6-ethylidene-10,13-dimethyl-7-oxo-3-propanoyloxy-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | C/C=C1\C(=O)C2C(CCC3(C)C2CCC3[C@H](C)CCC(=O)OCC)C2(C)CC[C@@H](OC(=O)CC)CC12.CC.CC |
| InChI | InChI=1S/C31H48O5.2C2H6/c1-7-21-25-18-20(36-26(32)8-2)14-16-31(25,6)24-15-17-30(5)22(11-12-23(30)28(24)29(21)34)19(4)10-13-27(33)35-9-3;2*1-2/h7,19-20,22-25,28H,8-18H2,1-6H3;2*1-2H3/b21-7-;;/t19-,20-,22?,23?,24?,25?,28?,30?,31?;;/m1../s1 |
| InChIKey | OVWRWDNEPQZOOK-DWKXRJFRSA-N |
| XLogP | 8.73 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.86 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|