C24H41NO6S — CID 130436286
[4-[(3R,7S,8S,9S,10S,13R,14S,17S)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoylamino]methanesulfonic acid (PubChem CID 130436286) has the molecular formula C24H41NO6S and a molecular weight of 471.66 g/mol. Its IUPAC name is [4-[(3R,7S,8S,9S,10S,13R,14S,17S)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoylamino]methanesulfonic acid.
| Compound Name | [4-[(3R,7S,8S,9S,10S,13R,14S,17S)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoylamino]methanesulfonic acid |
|---|---|
| PubChem CID | 130436286 |
| Molecular Formula | C24H41NO6S |
| Molecular Weight | 471.66 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | [4-[(3R,7S,8S,9S,10S,13R,14S,17S)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoylamino]methanesulfonic acid |
| SMILES | C[C@]12CC[C@H]3[C@@H]([C@@H](O)CC4C[C@H](O)CC[C@@]43C)[C@@H]1CC[C@@H]2CCCC(=O)NCS(=O)(=O)O |
| InChI | InChI=1S/C24H41NO6S/c1-23-11-9-19-22(20(27)13-16-12-17(26)8-10-24(16,19)2)18(23)7-6-15(23)4-3-5-21(28)25-14-32(29,30)31/h15-20,22,26-27H,3-14H2,1-2H3,(H,25,28)(H,29,30,31)/t15-,16?,17+,18-,19-,20-,22-,23+,24-/m0/s1 |
| InChIKey | LBNKQUJIOYQBDB-IMFULPGDSA-N |
| XLogP | 3.11 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.66 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|