C25H43NO5S — CID 121245681
2-[4-[(8S,9R,13R,17S)-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoylamino]ethanesulfonic acid (PubChem CID 121245681) has the molecular formula C25H43NO5S and a molecular weight of 469.69 g/mol. Its IUPAC name is 2-[4-[(8S,9R,13R,17S)-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoylamino]ethanesulfonic acid.
| Compound Name | 2-[4-[(8S,9R,13R,17S)-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 121245681 |
| Molecular Formula | C25H43NO5S |
| Molecular Weight | 469.69 g/mol |
| Exact Mass | 469.29 |
| IUPAC Name | 2-[4-[(8S,9R,13R,17S)-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoylamino]ethanesulfonic acid |
| SMILES | CC12CCCCC1CC(O)[C@H]1C3CC[C@H](CCCC(=O)NCCS(=O)(=O)O)[C@@]3(C)CC[C@H]12 |
| InChI | InChI=1S/C25H43NO5S/c1-24-12-4-3-6-18(24)16-21(27)23-19-10-9-17(25(19,2)13-11-20(23)24)7-5-8-22(28)26-14-15-32(29,30)31/h17-21,23,27H,3-16H2,1-2H3,(H,26,28)(H,29,30,31)/t17-,18?,19?,20+,21?,23-,24?,25+/m0/s1 |
| InChIKey | ZEPXATHHSPTHTC-CZFUTFJQSA-N |
| XLogP | 4.18 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.69 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|