C27H47NO2 — CID 167055099
(4R)-4-(7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-propylpentanamide (PubChem CID 167055099) has the molecular formula C27H47NO2 and a molecular weight of 417.68 g/mol. Its IUPAC name is (4R)-4-(7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-propylpentanamide.
| Compound Name | (4R)-4-(7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-propylpentanamide |
|---|---|
| PubChem CID | 167055099 |
| Molecular Formula | C27H47NO2 |
| Molecular Weight | 417.68 g/mol |
| Exact Mass | 417.36 |
| IUPAC Name | (4R)-4-(7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-propylpentanamide |
| SMILES | CCCNC(=O)CC[C@@H](C)C1CCC2C3C(O)CC4CCCCC4(C)C3CCC21C |
| InChI | InChI=1S/C27H47NO2/c1-5-16-28-24(30)12-9-18(2)20-10-11-21-25-22(13-15-27(20,21)4)26(3)14-7-6-8-19(26)17-23(25)29/h18-23,25,29H,5-17H2,1-4H3,(H,28,30)/t18-,19?,20?,21?,22?,23?,25?,26?,27?/m1/s1 |
| InChIKey | KOBKZMVPKBYDDA-YDNIVWEPSA-N |
| XLogP | 5.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.68 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |