C27H47NO — CID 145157664
4-[(8R,10S,13R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-propylpentanamide (PubChem CID 145157664) has the molecular formula C27H47NO and a molecular weight of 401.68 g/mol. Its IUPAC name is 4-[(8R,10S,13R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-propylpentanamide.
| Compound Name | 4-[(8R,10S,13R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-propylpentanamide |
|---|---|
| PubChem CID | 145157664 |
| Molecular Formula | C27H47NO |
| Molecular Weight | 401.68 g/mol |
| Exact Mass | 401.37 |
| IUPAC Name | 4-[(8R,10S,13R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-propylpentanamide |
| SMILES | CCCNC(=O)CCC(C)C1CCC2[C@@H]3CCC4CCCC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C27H47NO/c1-5-18-28-25(29)14-9-19(2)22-12-13-23-21-11-10-20-8-6-7-16-26(20,3)24(21)15-17-27(22,23)4/h19-24H,5-18H2,1-4H3,(H,28,29)/t19?,20?,21-,22?,23?,24?,26-,27+/m0/s1 |
| InChIKey | OFGUYRXDZPIFNK-ZMSKCGQHSA-N |
| XLogP | 6.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.68 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |