C27H49NO2 — CID 145157647
4-[(5S,8R,10S,13R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-ethylpentanamide;methanol (PubChem CID 145157647) has the molecular formula C27H49NO2 and a molecular weight of 419.69 g/mol. Its IUPAC name is 4-[(5S,8R,10S,13R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-ethylpentanamide;methanol.
| Compound Name | 4-[(5S,8R,10S,13R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-ethylpentanamide;methanol |
|---|---|
| PubChem CID | 145157647 |
| Molecular Formula | C27H49NO2 |
| Molecular Weight | 419.69 g/mol |
| Exact Mass | 419.38 |
| IUPAC Name | 4-[(5S,8R,10S,13R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-ethylpentanamide;methanol |
| SMILES | CCNC(=O)CCC(C)C1CCC2[C@@H]3CC[C@@H]4CCCC[C@]4(C)C3CC[C@]12C.CO |
| InChI | InChI=1S/C26H45NO.CH4O/c1-5-27-24(28)14-9-18(2)21-12-13-22-20-11-10-19-8-6-7-16-25(19,3)23(20)15-17-26(21,22)4;1-2/h18-23H,5-17H2,1-4H3,(H,27,28);2H,1H3/t18?,19-,20-,21?,22?,23?,25-,26+;/m0./s1 |
| InChIKey | FNQTWWWOUCRCNN-ADRIRUKDSA-N |
| XLogP | 6.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.69 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |