C29H49NO3 — CID 177226286
methyl 4-[[(4R)-4-[(5S,8R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]butanoate (PubChem CID 177226286) has the molecular formula C29H49NO3 and a molecular weight of 459.72 g/mol. Its IUPAC name is methyl 4-[[(4R)-4-[(5S,8R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]butanoate.
| Compound Name | methyl 4-[[(4R)-4-[(5S,8R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]butanoate |
|---|---|
| PubChem CID | 177226286 |
| Molecular Formula | C29H49NO3 |
| Molecular Weight | 459.72 g/mol |
| Exact Mass | 459.37 |
| IUPAC Name | methyl 4-[[(4R)-4-[(5S,8R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)CC[C@@H](C)C1CCC2[C@@H]3CC[C@@H]4CCCCC4(C)C3CCC21C |
| InChI | InChI=1S/C29H49NO3/c1-20(10-15-26(31)30-19-7-9-27(32)33-4)23-13-14-24-22-12-11-21-8-5-6-17-28(21,2)25(22)16-18-29(23,24)3/h20-25H,5-19H2,1-4H3,(H,30,31)/t20-,21+,22+,23?,24?,25?,28?,29?/m1/s1 |
| InChIKey | QVMDRZJKWJZDHR-OSYSLNSRSA-N |
| XLogP | 6.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.72 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|