C29H52NO5P — CID 156817803
[5-[[(3R)-3-(7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)butyl]amino]-2-methyl-5-oxopentyl]phosphonic acid (PubChem CID 156817803) has the molecular formula C29H52NO5P and a molecular weight of 525.71 g/mol. Its IUPAC name is [5-[[(3R)-3-(7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)butyl]amino]-2-methyl-5-oxopentyl]phosphonic acid.
| Compound Name | [5-[[(3R)-3-(7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)butyl]amino]-2-methyl-5-oxopentyl]phosphonic acid |
|---|---|
| PubChem CID | 156817803 |
| Molecular Formula | C29H52NO5P |
| Molecular Weight | 525.71 g/mol |
| Exact Mass | 525.36 |
| IUPAC Name | [5-[[(3R)-3-(7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)butyl]amino]-2-methyl-5-oxopentyl]phosphonic acid |
| SMILES | CC(CCC(=O)NCC[C@@H](C)C1CCC2C3C(O)CC4CCCCC4(C)C3CCC21C)CP(=O)(O)O |
| InChI | InChI=1S/C29H52NO5P/c1-19(18-36(33,34)35)8-11-26(32)30-16-13-20(2)22-9-10-23-27-24(12-15-29(22,23)4)28(3)14-6-5-7-21(28)17-25(27)31/h19-25,27,31H,5-18H2,1-4H3,(H,30,32)(H2,33,34,35)/t19?,20-,21?,22?,23?,24?,25?,27?,28?,29?/m1/s1 |
| InChIKey | CZUGFMGAJZANMB-PPJPOJCNSA-N |
| XLogP | 5.74 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.71 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|