C15H19F3N2O3 — CID 147822400
ethyl 4-methyl-1-[[5-(trifluoromethyl)-1H-pyrazol-3-yl]oxymethyl]cyclohex-3-ene-1-carboxylate (PubChem CID 147822400) has the molecular formula C15H19F3N2O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is ethyl 4-methyl-1-[[5-(trifluoromethyl)-1H-pyrazol-3-yl]oxymethyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 4-methyl-1-[[5-(trifluoromethyl)-1H-pyrazol-3-yl]oxymethyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 147822400 |
| Molecular Formula | C15H19F3N2O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | ethyl 4-methyl-1-[[5-(trifluoromethyl)-1H-pyrazol-3-yl]oxymethyl]cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1(COc2cc(C(F)(F)F)[nH]n2)CC=C(C)CC1 |
| InChI | InChI=1S/C15H19F3N2O3/c1-3-22-13(21)14(6-4-10(2)5-7-14)9-23-12-8-11(19-20-12)15(16,17)18/h4,8H,3,5-7,9H2,1-2H3,(H,19,20) |
| InChIKey | HPMJRIJHVUWHFQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|