C8H11F3O4S — CID 118626274
[2-(hydroxymethyl)-3-methylcyclopenten-1-yl] trifluoromethanesulfonate (PubChem CID 118626274) has the molecular formula C8H11F3O4S and a molecular weight of 260.23 g/mol. Its IUPAC name is [2-(hydroxymethyl)-3-methylcyclopenten-1-yl] trifluoromethanesulfonate.
| Compound Name | [2-(hydroxymethyl)-3-methylcyclopenten-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118626274 |
| Molecular Formula | C8H11F3O4S |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | [2-(hydroxymethyl)-3-methylcyclopenten-1-yl] trifluoromethanesulfonate |
| SMILES | CC1CCC(OS(=O)(=O)C(F)(F)F)=C1CO |
| InChI | InChI=1S/C8H11F3O4S/c1-5-2-3-7(6(5)4-12)15-16(13,14)8(9,10)11/h5,12H,2-4H2,1H3 |
| InChIKey | SXVIIAAAADABIH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|