C8H11F3O3S — CID 134863427
[(3R)-3-methylcyclohexen-1-yl] trifluoromethanesulfonate (PubChem CID 134863427) has the molecular formula C8H11F3O3S and a molecular weight of 244.23 g/mol. Its IUPAC name is [(3R)-3-methylcyclohexen-1-yl] trifluoromethanesulfonate.
| Compound Name | [(3R)-3-methylcyclohexen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134863427 |
| Molecular Formula | C8H11F3O3S |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | [(3R)-3-methylcyclohexen-1-yl] trifluoromethanesulfonate |
| SMILES | C[C@H]1C=C(OS(=O)(=O)C(F)(F)F)CCC1 |
| InChI | InChI=1S/C8H11F3O3S/c1-6-3-2-4-7(5-6)14-15(12,13)8(9,10)11/h5-6H,2-4H2,1H3/t6-/m1/s1 |
| InChIKey | UQMWJYFPFGXNAW-ZCFIWIBFSA-N |
| XLogP | 2.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|