C9H10F3NO5S — CID 90767853
3-(trifluoromethylsulfonyloxy)-6-azabicyclo[3.2.1]oct-2-ene-6-carboxylic acid (PubChem CID 90767853) has the molecular formula C9H10F3NO5S and a molecular weight of 301.24 g/mol. Its IUPAC name is 3-(trifluoromethylsulfonyloxy)-6-azabicyclo[3.2.1]oct-2-ene-6-carboxylic acid.
| Compound Name | 3-(trifluoromethylsulfonyloxy)-6-azabicyclo[3.2.1]oct-2-ene-6-carboxylic acid |
|---|---|
| PubChem CID | 90767853 |
| Molecular Formula | C9H10F3NO5S |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 3-(trifluoromethylsulfonyloxy)-6-azabicyclo[3.2.1]oct-2-ene-6-carboxylic acid |
| SMILES | O=C(O)N1CC2C=C(OS(=O)(=O)C(F)(F)F)CC1C2 |
| InChI | InChI=1S/C9H10F3NO5S/c10-9(11,12)19(16,17)18-7-2-5-1-6(3-7)13(4-5)8(14)15/h2,5-6H,1,3-4H2,(H,14,15) |
| InChIKey | IKMMOYNRULEJCL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|