C7H6F3NO7S — CID 123636416
4-(trifluoromethylsulfonyloxy)-2,3-dihydropyrrole-1,2-dicarboxylic acid (PubChem CID 123636416) has the molecular formula C7H6F3NO7S and a molecular weight of 305.19 g/mol. Its IUPAC name is 4-(trifluoromethylsulfonyloxy)-2,3-dihydropyrrole-1,2-dicarboxylic acid.
| Compound Name | 4-(trifluoromethylsulfonyloxy)-2,3-dihydropyrrole-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 123636416 |
| Molecular Formula | C7H6F3NO7S |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | 4-(trifluoromethylsulfonyloxy)-2,3-dihydropyrrole-1,2-dicarboxylic acid |
| SMILES | O=C(O)C1CC(OS(=O)(=O)C(F)(F)F)=CN1C(=O)O |
| InChI | InChI=1S/C7H6F3NO7S/c8-7(9,10)19(16,17)18-3-1-4(5(12)13)11(2-3)6(14)15/h2,4H,1H2,(H,12,13)(H,14,15) |
| InChIKey | XZAZSFKPULYHED-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|