C17H25F3N2O4S — CID 159152847
8-methyl-8-azabicyclo[3.2.1]octan-3-one;(8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl) trifluoromethanesulfonate (PubChem CID 159152847) has the molecular formula C17H25F3N2O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is 8-methyl-8-azabicyclo[3.2.1]octan-3-one;(8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl) trifluoromethanesulfonate.
| Compound Name | 8-methyl-8-azabicyclo[3.2.1]octan-3-one;(8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159152847 |
| Molecular Formula | C17H25F3N2O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 8-methyl-8-azabicyclo[3.2.1]octan-3-one;(8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl) trifluoromethanesulfonate |
| SMILES | CN1C2C=C(OS(=O)(=O)C(F)(F)F)CC1CC2.CN1C2CCC1CC(=O)C2 |
| InChI | InChI=1S/C9H12F3NO3S.C8H13NO/c1-13-6-2-3-7(13)5-8(4-6)16-17(14,15)9(10,11)12;1-9-6-2-3-7(9)5-8(10)4-6/h4,6-7H,2-3,5H2,1H3;6-7H,2-5H2,1H3 |
| InChIKey | KJNFTXQIFHAQST-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|