C23H27Cl2NO5S — CID 154996432
(2S)-2-(2,2-dichloro-3-oxocyclobutyl)-N,N-bis[(4-methoxyphenyl)methyl]propane-1-sulfonamide (PubChem CID 154996432) has the molecular formula C23H27Cl2NO5S and a molecular weight of 500.44 g/mol. Its IUPAC name is (2S)-2-(2,2-dichloro-3-oxocyclobutyl)-N,N-bis[(4-methoxyphenyl)methyl]propane-1-sulfonamide.
| Compound Name | (2S)-2-(2,2-dichloro-3-oxocyclobutyl)-N,N-bis[(4-methoxyphenyl)methyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 154996432 |
| Molecular Formula | C23H27Cl2NO5S |
| Molecular Weight | 500.44 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | (2S)-2-(2,2-dichloro-3-oxocyclobutyl)-N,N-bis[(4-methoxyphenyl)methyl]propane-1-sulfonamide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)(=O)C[C@@H](C)C2CC(=O)C2(Cl)Cl)cc1 |
| InChI | InChI=1S/C23H27Cl2NO5S/c1-16(21-12-22(27)23(21,24)25)15-32(28,29)26(13-17-4-8-19(30-2)9-5-17)14-18-6-10-20(31-3)11-7-18/h4-11,16,21H,12-15H2,1-3H3/t16-,21?/m1/s1 |
| InChIKey | ZGVSJOWUKIRMII-UJONTBEJSA-N |
| XLogP | 4.43 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|