C13H19NO6S — CID 60949142
3-[2-(4-methoxyphenoxy)ethyl-methylsulfamoyl]propanoic acid (PubChem CID 60949142) has the molecular formula C13H19NO6S and a molecular weight of 317.36 g/mol. Its IUPAC name is 3-[2-(4-methoxyphenoxy)ethyl-methylsulfamoyl]propanoic acid.
| Compound Name | 3-[2-(4-methoxyphenoxy)ethyl-methylsulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 60949142 |
| Molecular Formula | C13H19NO6S |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 3-[2-(4-methoxyphenoxy)ethyl-methylsulfamoyl]propanoic acid |
| SMILES | COc1ccc(OCCN(C)S(=O)(=O)CCC(=O)O)cc1 |
| InChI | InChI=1S/C13H19NO6S/c1-14(21(17,18)10-7-13(15)16)8-9-20-12-5-3-11(19-2)4-6-12/h3-6H,7-10H2,1-2H3,(H,15,16) |
| InChIKey | GXXZQDJKKIFTRY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |