C20H33N3O4 — CID 163880506
(2S,3R)-3-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]-N-hydroxy-6-phenylhexan-2-amine oxide (PubChem CID 163880506) has the molecular formula C20H33N3O4 and a molecular weight of 379.50 g/mol. Its IUPAC name is (2S,3R)-3-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]-N-hydroxy-6-phenylhexan-2-amine oxide.
| Compound Name | (2S,3R)-3-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]-N-hydroxy-6-phenylhexan-2-amine oxide |
|---|---|
| PubChem CID | 163880506 |
| Molecular Formula | C20H33N3O4 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | (2S,3R)-3-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]-N-hydroxy-6-phenylhexan-2-amine oxide |
| SMILES | CNC(=O)[C@@H](NC(=O)[C@H](CCCc1ccccc1)[C@H](C)[NH+]([O-])O)C(C)(C)C |
| InChI | InChI=1S/C20H33N3O4/c1-14(23(26)27)16(13-9-12-15-10-7-6-8-11-15)18(24)22-17(19(25)21-5)20(2,3)4/h6-8,10-11,14,16-17,23,26H,9,12-13H2,1-5H3,(H,21,25)(H,22,24)/t14-,16+,17+/m0/s1 |
| InChIKey | PSUFEIHZXDKICT-USXIJHARSA-N |
| XLogP | 1.06 |
| TPSA | 105.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|