C32H48N4O4 — CID 123695596
N-[3,3-dimethyl-1-(2-morpholin-4-ylethylamino)-1-oxobutan-2-yl]-5-phenyl-2-[1-(phenylmethoxyamino)ethyl]pentanamide (PubChem CID 123695596) has the molecular formula C32H48N4O4 and a molecular weight of 552.76 g/mol. Its IUPAC name is N-[3,3-dimethyl-1-(2-morpholin-4-ylethylamino)-1-oxobutan-2-yl]-5-phenyl-2-[1-(phenylmethoxyamino)ethyl]pentanamide.
| Compound Name | N-[3,3-dimethyl-1-(2-morpholin-4-ylethylamino)-1-oxobutan-2-yl]-5-phenyl-2-[1-(phenylmethoxyamino)ethyl]pentanamide |
|---|---|
| PubChem CID | 123695596 |
| Molecular Formula | C32H48N4O4 |
| Molecular Weight | 552.76 g/mol |
| Exact Mass | 552.37 |
| IUPAC Name | N-[3,3-dimethyl-1-(2-morpholin-4-ylethylamino)-1-oxobutan-2-yl]-5-phenyl-2-[1-(phenylmethoxyamino)ethyl]pentanamide |
| SMILES | CC(NOCc1ccccc1)C(CCCc1ccccc1)C(=O)NC(C(=O)NCCN1CCOCC1)C(C)(C)C |
| InChI | InChI=1S/C32H48N4O4/c1-25(35-40-24-27-14-9-6-10-15-27)28(17-11-16-26-12-7-5-8-13-26)30(37)34-29(32(2,3)4)31(38)33-18-19-36-20-22-39-23-21-36/h5-10,12-15,25,28-29,35H,11,16-24H2,1-4H3,(H,33,38)(H,34,37) |
| InChIKey | FMGAHAKAGVOPCE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.76 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|