C24H37ClN4O5 — CID 123941296
2-[[2-[(4-chlorophenyl)methyl]-3-[formyl(hydroxy)amino]butanoyl]amino]-3,3-dimethyl-N-(2-morpholin-4-ylethyl)butanamide (PubChem CID 123941296) has the molecular formula C24H37ClN4O5 and a molecular weight of 497.04 g/mol. Its IUPAC name is 2-[[2-[(4-chlorophenyl)methyl]-3-[formyl(hydroxy)amino]butanoyl]amino]-3,3-dimethyl-N-(2-morpholin-4-ylethyl)butanamide.
| Compound Name | 2-[[2-[(4-chlorophenyl)methyl]-3-[formyl(hydroxy)amino]butanoyl]amino]-3,3-dimethyl-N-(2-morpholin-4-ylethyl)butanamide |
|---|---|
| PubChem CID | 123941296 |
| Molecular Formula | C24H37ClN4O5 |
| Molecular Weight | 497.04 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 2-[[2-[(4-chlorophenyl)methyl]-3-[formyl(hydroxy)amino]butanoyl]amino]-3,3-dimethyl-N-(2-morpholin-4-ylethyl)butanamide |
| SMILES | CC(C(Cc1ccc(Cl)cc1)C(=O)NC(C(=O)NCCN1CCOCC1)C(C)(C)C)N(O)C=O |
| InChI | InChI=1S/C24H37ClN4O5/c1-17(29(33)16-30)20(15-18-5-7-19(25)8-6-18)22(31)27-21(24(2,3)4)23(32)26-9-10-28-11-13-34-14-12-28/h5-8,16-17,20-21,33H,9-15H2,1-4H3,(H,26,32)(H,27,31) |
| InChIKey | PSRJTBKPBKGOTA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.04 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|